C39H51N3O4S — CID 162239799
tert-butyl (2R,5S)-8-(1-aminoethylideneamino)-5-[(3-ethyloxetan-3-yl)amino]-4-oxo-2-(tritylsulfanylmethyl)octanoate (PubChem CID 162239799) has the molecular formula C39H51N3O4S and a molecular weight of 657.92 g/mol. Its IUPAC name is tert-butyl (2R,5S)-8-(1-aminoethylideneamino)-5-[(3-ethyloxetan-3-yl)amino]-4-oxo-2-(tritylsulfanylmethyl)octanoate.
| Compound Name | tert-butyl (2R,5S)-8-(1-aminoethylideneamino)-5-[(3-ethyloxetan-3-yl)amino]-4-oxo-2-(tritylsulfanylmethyl)octanoate |
|---|---|
| PubChem CID | 162239799 |
| Molecular Formula | C39H51N3O4S |
| Molecular Weight | 657.92 g/mol |
| Exact Mass | 657.36 |
| IUPAC Name | tert-butyl (2R,5S)-8-(1-aminoethylideneamino)-5-[(3-ethyloxetan-3-yl)amino]-4-oxo-2-(tritylsulfanylmethyl)octanoate |
| SMILES | CCC1(N[C@@H](CCC/N=C(\C)N)C(=O)C[C@@H](CSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OC(C)(C)C)COC1 |
| InChI | InChI=1S/C39H51N3O4S/c1-6-38(27-45-28-38)42-34(23-16-24-41-29(2)40)35(43)25-30(36(44)46-37(3,4)5)26-47-39(31-17-10-7-11-18-31,32-19-12-8-13-20-32)33-21-14-9-15-22-33/h7-15,17-22,30,34,42H,6,16,23-28H2,1-5H3,(H2,40,41)/t30-,34-/m0/s1 |
| InChIKey | JTDCRZQSAAMALF-NHZFLZHXSA-N |
| XLogP | 6.92 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.92 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|