C25H39N3O7 — CID 139552679
1-O-tert-butyl 4-O-(2-phenylpropan-2-yl) 2-[(2-methylpropan-2-yl)oxy]-3-[[3-(nitromethyl)azetidin-3-yl]amino]butanedioate (PubChem CID 139552679) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(2-phenylpropan-2-yl) 2-[(2-methylpropan-2-yl)oxy]-3-[[3-(nitromethyl)azetidin-3-yl]amino]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-(2-phenylpropan-2-yl) 2-[(2-methylpropan-2-yl)oxy]-3-[[3-(nitromethyl)azetidin-3-yl]amino]butanedioate |
|---|---|
| PubChem CID | 139552679 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 1-O-tert-butyl 4-O-(2-phenylpropan-2-yl) 2-[(2-methylpropan-2-yl)oxy]-3-[[3-(nitromethyl)azetidin-3-yl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)C(OC(C)(C)C)C(NC1(C[N+](=O)[O-])CNC1)C(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H39N3O7/c1-22(2,3)33-19(21(30)34-23(4,5)6)18(27-25(14-26-15-25)16-28(31)32)20(29)35-24(7,8)17-12-10-9-11-13-17/h9-13,18-19,26-27H,14-16H2,1-8H3 |
| InChIKey | SPQFYVJFTCZABN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|