C17H19F4NO5 — CID 135032075
2-[1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(trifluoromethyl)prop-2-enoxy]-6-fluoropyridine (PubChem CID 135032075) has the molecular formula C17H19F4NO5 and a molecular weight of 393.33 g/mol. Its IUPAC name is 2-[1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(trifluoromethyl)prop-2-enoxy]-6-fluoropyridine.
| Compound Name | 2-[1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(trifluoromethyl)prop-2-enoxy]-6-fluoropyridine |
|---|---|
| PubChem CID | 135032075 |
| Molecular Formula | C17H19F4NO5 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(trifluoromethyl)prop-2-enoxy]-6-fluoropyridine |
| SMILES | C=C(C(Oc1cccc(F)n1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC)C(F)(F)F |
| InChI | InChI=1S/C17H19F4NO5/c1-8(17(19,20)21)11(24-10-7-5-6-9(18)22-10)13-12(23-4)14-15(25-13)27-16(2,3)26-14/h5-7,11-15H,1H2,2-4H3/t11?,12-,13+,14+,15+/m0/s1 |
| InChIKey | LGIHUTAFXSGYSY-ADSKKKOISA-N |
| XLogP | 2.98 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|