C23H34O5 — CID 135032231
tert-butyl 3-[(5R)-5,11,11-trimethyl-4-oxo-10,12-dioxatetracyclo[6.5.2.01,6.09,13]pentadec-2-en-5-yl]propanoate (PubChem CID 135032231) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl 3-[(5R)-5,11,11-trimethyl-4-oxo-10,12-dioxatetracyclo[6.5.2.01,6.09,13]pentadec-2-en-5-yl]propanoate.
| Compound Name | tert-butyl 3-[(5R)-5,11,11-trimethyl-4-oxo-10,12-dioxatetracyclo[6.5.2.01,6.09,13]pentadec-2-en-5-yl]propanoate |
|---|---|
| PubChem CID | 135032231 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl 3-[(5R)-5,11,11-trimethyl-4-oxo-10,12-dioxatetracyclo[6.5.2.01,6.09,13]pentadec-2-en-5-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@]1(C)C(=O)C=CC23CCC(CC21)C1OC(C)(C)OC13 |
| InChI | InChI=1S/C23H34O5/c1-20(2,3)26-17(25)9-10-22(6)15-13-14-7-11-23(15,12-8-16(22)24)19-18(14)27-21(4,5)28-19/h8,12,14-15,18-19H,7,9-11,13H2,1-6H3/t14?,15?,18?,19?,22-,23?/m1/s1 |
| InChIKey | GNLHWTZOBYJQNZ-YUFNUBBSSA-N |
| XLogP | 4.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |