C31H44O6SSi — CID 135032364
[(3R,5S,6R)-4-benzoyloxy-6-ethylsulfanyl-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate (PubChem CID 135032364) has the molecular formula C31H44O6SSi and a molecular weight of 572.84 g/mol. Its IUPAC name is [(3R,5S,6R)-4-benzoyloxy-6-ethylsulfanyl-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate.
| Compound Name | [(3R,5S,6R)-4-benzoyloxy-6-ethylsulfanyl-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 135032364 |
| Molecular Formula | C31H44O6SSi |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [(3R,5S,6R)-4-benzoyloxy-6-ethylsulfanyl-2-methyl-5-tri(propan-2-yl)silyloxyoxan-3-yl] benzoate |
| SMILES | CCS[C@H]1OC(C)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H44O6SSi/c1-9-38-31-28(37-39(20(2)3,21(4)5)22(6)7)27(36-30(33)25-18-14-11-15-19-25)26(23(8)34-31)35-29(32)24-16-12-10-13-17-24/h10-23,26-28,31H,9H2,1-8H3/t23?,26-,27?,28+,31-/m1/s1 |
| InChIKey | IWIOGFBVGXRDRO-REQQICJFSA-N |
| XLogP | 7.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|