C16H15N3O2S — CID 135033006
(4S)-4-benzyl-N-(3-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 135033006) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is (4S)-4-benzyl-N-(3-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (4S)-4-benzyl-N-(3-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135033006 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (4S)-4-benzyl-N-(3-nitrophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(NC2=N[C@@H](Cc3ccccc3)CS2)c1 |
| InChI | InChI=1S/C16H15N3O2S/c20-19(21)15-8-4-7-13(10-15)17-16-18-14(11-22-16)9-12-5-2-1-3-6-12/h1-8,10,14H,9,11H2,(H,17,18)/t14-/m0/s1 |
| InChIKey | KBVLCNQPZNUUDR-AWEZNQCLSA-N |
| XLogP | 3.72 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|