C22H15F3N2O — CID 135033156
5-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-2-one (PubChem CID 135033156) has the molecular formula C22H15F3N2O and a molecular weight of 380.37 g/mol. Its IUPAC name is 5-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-2-one.
| Compound Name | 5-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 135033156 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2ccccc2N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15F3N2O/c23-22(24,25)16-9-6-10-17(13-16)27-19-12-5-4-11-18(19)21(26-14-20(27)28)15-7-2-1-3-8-15/h1-13H,14H2 |
| InChIKey | BJZKWNZBSATCOA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |