C23H31IO5 — CID 135033470
CID 135033470 (PubChem CID 135033470) has the molecular formula C23H31IO5 and a molecular weight of 514.40 g/mol.
| Compound Name | CID 135033470 |
|---|---|
| PubChem CID | 135033470 |
| Molecular Formula | C23H31IO5 |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | — |
| SMILES | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC5(CC[C@@]43CI)OCCO5)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H31IO5/c1-20-13-18(25)19-16(17(20)4-5-23(20)28-10-11-29-23)3-2-15-12-22(26-8-9-27-22)7-6-21(15,19)14-24/h12,16-17,19H,2-11,13-14H2,1H3/t16-,17-,19+,20-,21+/m0/s1 |
| InChIKey | BIJDXJPOYLDUDZ-FFZBTMFNSA-N |
| XLogP | 4.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|