C25H37NO6 — CID 174217376
[(2'R,3'S,8'S,9'S,10'R,13'S,14'S)-3'-(dimethylamino)-2'-hydroxy-10',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,17'-2,3,6,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-1'-yl] acetate (PubChem CID 174217376) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is [(2'R,3'S,8'S,9'S,10'R,13'S,14'S)-3'-(dimethylamino)-2'-hydroxy-10',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,17'-2,3,6,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-1'-yl] acetate.
| Compound Name | [(2'R,3'S,8'S,9'S,10'R,13'S,14'S)-3'-(dimethylamino)-2'-hydroxy-10',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,17'-2,3,6,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-1'-yl] acetate |
|---|---|
| PubChem CID | 174217376 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | [(2'R,3'S,8'S,9'S,10'R,13'S,14'S)-3'-(dimethylamino)-2'-hydroxy-10',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,17'-2,3,6,7,8,9,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-1'-yl] acetate |
| SMILES | CC(=O)OC1[C@H](O)[C@@H](N(C)C)C=C2CC[C@H]3[C@@H]4CCC5(OCCO5)[C@@]4(C)CC(=O)[C@@H]3[C@]21C |
| InChI | InChI=1S/C25H37NO6/c1-14(27)32-22-21(29)18(26(4)5)12-15-6-7-16-17-8-9-25(30-10-11-31-25)23(17,2)13-19(28)20(16)24(15,22)3/h12,16-18,20-22,29H,6-11,13H2,1-5H3/t16-,17-,18-,20+,21+,22?,23-,24-/m0/s1 |
| InChIKey | POFKZSPVQGCHAF-DFGMOCRFSA-N |
| XLogP | 2.31 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|