C21H30INO3 — CID 174217381
(2R,3S,8S,9S,10R,13S,14S)-3-(dimethylamino)-1,2-dihydroxy-17-iodo-10,13-dimethyl-1,2,3,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one (PubChem CID 174217381) has the molecular formula C21H30INO3 and a molecular weight of 471.38 g/mol. Its IUPAC name is (2R,3S,8S,9S,10R,13S,14S)-3-(dimethylamino)-1,2-dihydroxy-17-iodo-10,13-dimethyl-1,2,3,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (2R,3S,8S,9S,10R,13S,14S)-3-(dimethylamino)-1,2-dihydroxy-17-iodo-10,13-dimethyl-1,2,3,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 174217381 |
| Molecular Formula | C21H30INO3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (2R,3S,8S,9S,10R,13S,14S)-3-(dimethylamino)-1,2-dihydroxy-17-iodo-10,13-dimethyl-1,2,3,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CN(C)[C@H]1C=C2CC[C@H]3[C@@H]4CC=C(I)[C@@]4(C)CC(=O)[C@@H]3[C@@]2(C)C(O)[C@@H]1O |
| InChI | InChI=1S/C21H30INO3/c1-20-10-15(24)17-12(13(20)7-8-16(20)22)6-5-11-9-14(23(3)4)18(25)19(26)21(11,17)2/h8-9,12-14,17-19,25-26H,5-7,10H2,1-4H3/t12-,13-,14-,17+,18+,19?,20-,21-/m0/s1 |
| InChIKey | XRASPTLCKOOLCQ-XPSVVMDBSA-N |
| XLogP | 2.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|