C21H29NO2 — CID 86736925
(5S,8S,9S,10S,13S,14S)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,4,5,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one (PubChem CID 86736925) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (5S,8S,9S,10S,13S,14S)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,4,5,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (5S,8S,9S,10S,13S,14S)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,4,5,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 86736925 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (5S,8S,9S,10S,13S,14S)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethyl-1,4,5,6,7,8,9,12,14,15-decahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC(=NO)C1=CC[C@H]2[C@@H]3CC[C@H]4CC=CC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C21H29NO2/c1-13(22-24)16-9-10-17-15-8-7-14-6-4-5-11-20(14,2)19(15)18(23)12-21(16,17)3/h4-5,9,14-15,17,19,24H,6-8,10-12H2,1-3H3/t14-,15+,17+,19-,20+,21-/m1/s1 |
| InChIKey | FNYMZCLQMMGCES-NECYCJOPSA-N |
| XLogP | 4.76 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|