C23H31NO7 — CID 24897580
(1'R,4'S,5'S,9'S,12'S,13'S,14'S,16'R,18'S,21'R)-21'-hydroxy-9',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,8'-15,20-dioxa-17-azahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane]-17'-carbaldehyde (PubChem CID 24897580) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is (1'R,4'S,5'S,9'S,12'S,13'S,14'S,16'R,18'S,21'R)-21'-hydroxy-9',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,8'-15,20-dioxa-17-azahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane]-17'-carbaldehyde.
| Compound Name | (1'R,4'S,5'S,9'S,12'S,13'S,14'S,16'R,18'S,21'R)-21'-hydroxy-9',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,8'-15,20-dioxa-17-azahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane]-17'-carbaldehyde |
|---|---|
| PubChem CID | 24897580 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (1'R,4'S,5'S,9'S,12'S,13'S,14'S,16'R,18'S,21'R)-21'-hydroxy-9',13'-dimethyl-11'-oxospiro[1,3-dioxolane-2,8'-15,20-dioxa-17-azahexacyclo[14.3.1.114,18.01,13.04,12.05,9]henicosane]-17'-carbaldehyde |
| SMILES | C[C@]12[C@@H]3O[C@@H]4O[C@]1(CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CCC21OCCO1)C[C@@H]([C@H]3O)N4C=O |
| InChI | InChI=1S/C23H31NO7/c1-20-10-15(26)16-12(13(20)4-6-23(20)28-7-8-29-23)3-5-22-9-14-17(27)18(21(16,22)2)30-19(31-22)24(14)11-25/h11-14,16-19,27H,3-10H2,1-2H3/t12-,13-,14-,16+,17+,18+,19+,20-,21-,22+/m0/s1 |
| InChIKey | XYWPYWOZPZIVOB-REFZPNRBSA-N |
| XLogP | 1.19 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|