C21H23F3O5S — CID 135034186
[(E)-[(8R,9S,13R,14S)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl] trifluoromethanesulfonate (PubChem CID 135034186) has the molecular formula C21H23F3O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is [(E)-[(8R,9S,13R,14S)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl] trifluoromethanesulfonate.
| Compound Name | [(E)-[(8R,9S,13R,14S)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135034186 |
| Molecular Formula | C21H23F3O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [(E)-[(8R,9S,13R,14S)-3-methoxy-13-methyl-17-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-ylidene]methyl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)C(=O)/C(=C/OS(=O)(=O)C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C21H23F3O5S/c1-20-8-7-16-15-6-4-14(28-2)9-12(15)3-5-17(16)18(20)10-13(19(20)25)11-29-30(26,27)21(22,23)24/h4,6,9,11,16-18H,3,5,7-8,10H2,1-2H3/b13-11+/t16-,17-,18+,20-/m1/s1 |
| InChIKey | RWKVBPNOQDUIOS-RAAAAISZSA-N |
| XLogP | 4.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|