C38H48O8SSi — CID 135036253
[(3S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-tri(propan-2-yl)silyloxyoxan-2-yl]methyl benzoate (PubChem CID 135036253) has the molecular formula C38H48O8SSi and a molecular weight of 692.95 g/mol. Its IUPAC name is [(3S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-tri(propan-2-yl)silyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-tri(propan-2-yl)silyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135036253 |
| Molecular Formula | C38H48O8SSi |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | [(3S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-tri(propan-2-yl)silyloxyoxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1OC(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H48O8SSi/c1-8-47-38-34(46-48(25(2)3,26(4)5)27(6)7)33(45-37(41)30-22-16-11-17-23-30)32(44-36(40)29-20-14-10-15-21-29)31(43-38)24-42-35(39)28-18-12-9-13-19-28/h9-23,25-27,31-34,38H,8,24H2,1-7H3/t31?,32-,33?,34?,38-/m0/s1 |
| InChIKey | MBHQKCHHMASHJW-QHKJIVMJSA-N |
| XLogP | 8.33 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|