C14H32O3Si2 — CID 135036795
(3S,4R)-3,4-bis(trimethylsilyloxy)octan-2-one (PubChem CID 135036795) has the molecular formula C14H32O3Si2 and a molecular weight of 304.58 g/mol. Its IUPAC name is (3S,4R)-3,4-bis(trimethylsilyloxy)octan-2-one.
| Compound Name | (3S,4R)-3,4-bis(trimethylsilyloxy)octan-2-one |
|---|---|
| PubChem CID | 135036795 |
| Molecular Formula | C14H32O3Si2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3S,4R)-3,4-bis(trimethylsilyloxy)octan-2-one |
| SMILES | CCCC[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(C)=O |
| InChI | InChI=1S/C14H32O3Si2/c1-9-10-11-13(16-18(3,4)5)14(12(2)15)17-19(6,7)8/h13-14H,9-11H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | ISMOCEPOLDUSPQ-ZIAGYGMSSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|