C15H20OS — CID 135037122
(6E)-6-(6-methylhept-5-en-2-yloxymethylidene)cyclohexa-2,4-diene-1-thione (PubChem CID 135037122) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (6E)-6-(6-methylhept-5-en-2-yloxymethylidene)cyclohexa-2,4-diene-1-thione.
| Compound Name | (6E)-6-(6-methylhept-5-en-2-yloxymethylidene)cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 135037122 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (6E)-6-(6-methylhept-5-en-2-yloxymethylidene)cyclohexa-2,4-diene-1-thione |
| SMILES | CC(C)=CCCC(C)O/C=C1\C=CC=CC1=S |
| InChI | InChI=1S/C15H20OS/c1-12(2)7-6-8-13(3)16-11-14-9-4-5-10-15(14)17/h4-5,7,9-11,13H,6,8H2,1-3H3/b14-11+ |
| InChIKey | XILQKRNDOSKZJJ-SDNWHVSQSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|