C9H12O2 — CID 135037319
(4E)-2-methylideneocta-4,7-dienoic acid (PubChem CID 135037319) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (4E)-2-methylideneocta-4,7-dienoic acid.
| Compound Name | (4E)-2-methylideneocta-4,7-dienoic acid |
|---|---|
| PubChem CID | 135037319 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (4E)-2-methylideneocta-4,7-dienoic acid |
| SMILES | C=CC/C=C/CC(=C)C(=O)O |
| InChI | InChI=1S/C9H12O2/c1-3-4-5-6-7-8(2)9(10)11/h3,5-6H,1-2,4,7H2,(H,10,11)/b6-5+ |
| InChIKey | BIMLRHVKCTTZHW-AATRIKPKSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|