About bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium
bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium (PubChem CID 135037431) has the molecular formula C12H18O2Y-2
and a molecular weight of 283.18 g/mol. Its IUPAC name is bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium.
Molecular Properties
| Compound Name | bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium |
| PubChem CID | 135037431 |
| Molecular Formula | C12H18O2Y-2 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium |
| SMILES | C=C([CH2-])/C=C/OC.C=C([CH2-])/C=C/OC.[Y] |
| InChI | InChI=1S/2C6H9O.Y/c2*1-6(2)4-5-7-3;/h2*4-5H,1-2H2,3H3;/q2*-1;/b2*5-4+; |
| InChIKey | XTQBVVSSVKAYHC-WDTNTSJCSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium?
The IUPAC name of bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium (CID 135037431) is bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium.
What is the SMILES notation for bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium?
The canonical SMILES for bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium is C=C([CH2-])/C=C/OC.C=C([CH2-])/C=C/OC.[Y].
What is the InChIKey of bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium?
The InChIKey is XTQBVVSSVKAYHC-WDTNTSJCSA-N. The full InChI is InChI=1S/2C6H9O.Y/c2*1-6(2)4-5-7-3;/h2*4-5H,1-2H2,3H3;/q2*-1;/b2*5-4+;.
What are the key properties of bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium?
bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium has a molecular weight of 283.18 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((1E)-3-methanidyl-1-methoxybuta-1,3-diene);yttrium is sourced from PubChem (CID 135037431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).