C11H17I — CID 135037814
(2Z,4E,6E)-2-iodo-4,6-dimethylnona-2,4,6-triene (PubChem CID 135037814) has the molecular formula C11H17I and a molecular weight of 276.16 g/mol. Its IUPAC name is (2Z,4E,6E)-2-iodo-4,6-dimethylnona-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-2-iodo-4,6-dimethylnona-2,4,6-triene |
|---|---|
| PubChem CID | 135037814 |
| Molecular Formula | C11H17I |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (2Z,4E,6E)-2-iodo-4,6-dimethylnona-2,4,6-triene |
| SMILES | CC/C=C(C)/C=C(C)/C=C(/C)I |
| InChI | InChI=1S/C11H17I/c1-5-6-9(2)7-10(3)8-11(4)12/h6-8H,5H2,1-4H3/b9-6+,10-7+,11-8- |
| InChIKey | JTFMBGBVYPBJSE-ATQUJFMQSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|