C10H15NO — CID 135037979
N-(1-cyclohexa-1,5-dien-1-ylethyl)acetamide (PubChem CID 135037979) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(1-cyclohexa-1,5-dien-1-ylethyl)acetamide.
| Compound Name | N-(1-cyclohexa-1,5-dien-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 135037979 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-(1-cyclohexa-1,5-dien-1-ylethyl)acetamide |
| SMILES | CC(=O)NC(C)C1=CCCC=C1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h4,6-8H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | QLRHRXQABUATBK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |