C18H27NO — CID 163067931
N-butan-2-yltetradeca-2,4,8,10,12-pentaenamide (PubChem CID 163067931) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-butan-2-yltetradeca-2,4,8,10,12-pentaenamide.
| Compound Name | N-butan-2-yltetradeca-2,4,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 163067931 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-butan-2-yltetradeca-2,4,8,10,12-pentaenamide |
| SMILES | CC=CC=CC=CCCC=CC=CC(=O)NC(C)CC |
| InChI | InChI=1S/C18H27NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-18(20)19-17(3)5-2/h4,6-10,13-17H,5,11-12H2,1-3H3,(H,19,20) |
| InChIKey | JUGNCEQNFAJJKT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|