C20H30O6 — CID 135038536
methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-2-hydroxy-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 135038536) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-2-hydroxy-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-2-hydroxy-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135038536 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl (1R,5S,8aS)-5-(3-acetyloxypropyl)-2-hydroxy-1,5,6-trimethyl-3-oxo-6,7,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(O)C(=O)C=C2[C@@H]1CCC(C)[C@]2(C)CCCOC(C)=O |
| InChI | InChI=1S/C20H30O6/c1-12-7-8-14-15(19(12,3)9-6-10-26-13(2)21)11-16(22)17(23)20(14,4)18(24)25-5/h11-12,14,17,23H,6-10H2,1-5H3/t12?,14-,17?,19-,20+/m0/s1 |
| InChIKey | HDNWNSVJQLAAOV-BPCGVDKCSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|