C10H19NO — CID 135039118
(NE)-N-[1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethylidene]hydroxylamine (PubChem CID 135039118) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (NE)-N-[1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 135039118 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (NE)-N-[1-[(1S,3R)-2,2,3-trimethylcyclopentyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)[C@H]1CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C10H19NO/c1-7-5-6-9(8(2)11-12)10(7,3)4/h7,9,12H,5-6H2,1-4H3/b11-8+/t7-,9-/m1/s1 |
| InChIKey | GVSRHZKELPPBTK-DTQAVVEUSA-N |
| XLogP | 2.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|