C14H17NO4 — CID 135039798
methyl (3S,7aR)-5-hydroxy-3-phenyl-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 135039798) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl (3S,7aR)-5-hydroxy-3-phenyl-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3S,7aR)-5-hydroxy-3-phenyl-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 135039798 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (3S,7aR)-5-hydroxy-3-phenyl-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(O)N1[C@H](c1ccccc1)OC2 |
| InChI | InChI=1S/C14H17NO4/c1-18-13(17)14-8-7-11(16)15(14)12(19-9-14)10-5-3-2-4-6-10/h2-6,11-12,16H,7-9H2,1H3/t11?,12-,14+/m0/s1 |
| InChIKey | QYNBYFRHFKVTNH-VBVNFKHJSA-N |
| XLogP | 1.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |