C30H44N2O8 — CID 24813701
1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(S)-hydroxy-[(2S,4S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-oxazolidin-4-yl]methyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 24813701) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(S)-hydroxy-[(2S,4S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-oxazolidin-4-yl]methyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(S)-hydroxy-[(2S,4S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-oxazolidin-4-yl]methyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 24813701 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(S)-hydroxy-[(2S,4S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-oxazolidin-4-yl]methyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1([C@@H](O)[C@@H]2CO[C@@H](c3ccccc3)N2C(=O)OC(C)(C)C)CC[C@H](C=C(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H44N2O8/c1-19(2)17-21-15-16-30(25(34)37-9,32(21)27(36)40-29(6,7)8)23(33)22-18-38-24(20-13-11-10-12-14-20)31(22)26(35)39-28(3,4)5/h10-14,17,21-24,33H,15-16,18H2,1-9H3/t21-,22+,23+,24+,30-/m1/s1 |
| InChIKey | BSOHAWXEXXCTBD-JENMSBQGSA-N |
| XLogP | 4.96 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|