C12H24O5Si — CID 135039964
(6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(dihydroxymethyl)oxan-2-one (PubChem CID 135039964) has the molecular formula C12H24O5Si and a molecular weight of 276.40 g/mol. Its IUPAC name is (6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(dihydroxymethyl)oxan-2-one.
| Compound Name | (6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(dihydroxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 135039964 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(dihydroxymethyl)oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=O)O[C@@H](C(O)O)C1 |
| InChI | InChI=1S/C12H24O5Si/c1-12(2,3)18(4,5)17-8-6-9(11(14)15)16-10(13)7-8/h8-9,11,14-15H,6-7H2,1-5H3/t8?,9-/m1/s1 |
| InChIKey | HWLXKOIOCVMPJP-YGPZHTELSA-N |
| XLogP | 1.39 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|