C13H21NO3 — CID 135040435
(3R,6R,7S,7aR)-3-tert-butyl-7-hydroxy-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 135040435) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (3R,6R,7S,7aR)-3-tert-butyl-7-hydroxy-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6R,7S,7aR)-3-tert-butyl-7-hydroxy-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 135040435 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3R,6R,7S,7aR)-3-tert-butyl-7-hydroxy-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CC[C@H]1C(=O)N2[C@H](CO[C@@H]2C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C13H21NO3/c1-5-6-8-10(15)9-7-17-12(13(2,3)4)14(9)11(8)16/h5,8-10,12,15H,1,6-7H2,2-4H3/t8-,9-,10+,12-/m1/s1 |
| InChIKey | RCVFYUJJDFBJCW-MWGHHZFTSA-N |
| XLogP | 1.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|