C17H14N2S — CID 1350413
N-phenyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine (PubChem CID 1350413) has the molecular formula C17H14N2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-phenyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine.
| Compound Name | N-phenyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 1350413 |
| Molecular Formula | C17H14N2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-phenyl-4,5-dihydrobenzo[e][1,3]benzothiazol-2-amine |
| SMILES | c1ccc(Nc2nc3c(s2)CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C17H14N2S/c1-2-7-13(8-3-1)18-17-19-16-14-9-5-4-6-12(14)10-11-15(16)20-17/h1-9H,10-11H2,(H,18,19) |
| InChIKey | YBHAKSVDEJAJSA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |