About 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane
4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane (PubChem CID 135042328) has the molecular formula C13H13BrSi
and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane |
| PubChem CID | 135042328 |
| Molecular Formula | C13H13BrSi |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC#Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrSi/c1-15(2,3)11-5-4-6-12-7-9-13(14)10-8-12/h7-10H,1-3H3 |
| InChIKey | RLIAGVOKCVZANN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane?
The IUPAC name of 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane (CID 135042328) is 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane.
What is the SMILES notation for 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane?
The canonical SMILES for 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane is C[Si](C)(C)C#CC#Cc1ccc(Br)cc1.
What is the InChIKey of 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane?
The InChIKey is RLIAGVOKCVZANN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrSi/c1-15(2,3)11-5-4-6-12-7-9-13(14)10-8-12/h7-10H,1-3H3.
What are the key properties of 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane?
4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane has a molecular weight of 277.24 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)buta-1,3-diynyl-trimethylsilane is sourced from PubChem (CID 135042328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).