C13H18O4 — CID 135044275
(1S,4R,6R,7R)-9-ethoxy-6-methyl-5,10-dioxatetracyclo[4.4.2.01,7.04,7]dodecan-3-one (PubChem CID 135044275) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1S,4R,6R,7R)-9-ethoxy-6-methyl-5,10-dioxatetracyclo[4.4.2.01,7.04,7]dodecan-3-one.
| Compound Name | (1S,4R,6R,7R)-9-ethoxy-6-methyl-5,10-dioxatetracyclo[4.4.2.01,7.04,7]dodecan-3-one |
|---|---|
| PubChem CID | 135044275 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1S,4R,6R,7R)-9-ethoxy-6-methyl-5,10-dioxatetracyclo[4.4.2.01,7.04,7]dodecan-3-one |
| SMILES | CCOC1C[C@@]23[C@H]4O[C@]2(C)CC[C@@]3(CC4=O)O1 |
| InChI | InChI=1S/C13H18O4/c1-3-15-9-7-13-10-8(14)6-12(13,16-9)5-4-11(13,2)17-10/h9-10H,3-7H2,1-2H3/t9?,10-,11+,12-,13+/m0/s1 |
| InChIKey | YDQWTGOKPVUWBB-NTWDBFDFSA-N |
| XLogP | 1.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |