C11H16F2N4O2 — CID 135044340
ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(1-methylpyrazol-4-yl)propanoate (PubChem CID 135044340) has the molecular formula C11H16F2N4O2 and a molecular weight of 274.27 g/mol. Its IUPAC name is ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(1-methylpyrazol-4-yl)propanoate.
| Compound Name | ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(1-methylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 135044340 |
| Molecular Formula | C11H16F2N4O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl (3E)-3-(dimethylhydrazinylidene)-2,2-difluoro-3-(1-methylpyrazol-4-yl)propanoate |
| SMILES | CCOC(=O)C(F)(F)/C(=N/N(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C11H16F2N4O2/c1-5-19-10(18)11(12,13)9(15-16(2)3)8-6-14-17(4)7-8/h6-7H,5H2,1-4H3/b15-9+ |
| InChIKey | IQMAOFKSLJNTTB-OQLLNIDSSA-N |
| XLogP | 0.88 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|