C14H24O — CID 135045350
1-octa-1,2-dienylcyclohexan-1-ol (PubChem CID 135045350) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-octa-1,2-dienylcyclohexan-1-ol.
| Compound Name | 1-octa-1,2-dienylcyclohexan-1-ol |
|---|---|
| PubChem CID | 135045350 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-octa-1,2-dienylcyclohexan-1-ol |
| SMILES | CCCCCC=C=CC1(O)CCCCC1 |
| InChI | InChI=1S/C14H24O/c1-2-3-4-5-6-8-11-14(15)12-9-7-10-13-14/h6,11,15H,2-5,7,9-10,12-13H2,1H3 |
| InChIKey | DKVHZVLLABFORE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|