C12H10O2 — CID 135045829
CID 135045829 (PubChem CID 135045829) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol.
| Compound Name | CID 135045829 |
|---|---|
| PubChem CID | 135045829 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C2[C](C[C]1)[C]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C12H10O2/c1-14-12(13)10-5-4-9-7-2-3-8(6-7)11(9)10/h2-3,8H,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | QWLQVCBGOYVUFY-MRVPVSSYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |