C15H29B — CID 135048513
9-(3,4-dimethylpentan-2-yl)-9-borabicyclo[3.3.1]nonane (PubChem CID 135048513) has the molecular formula C15H29B and a molecular weight of 220.21 g/mol. Its IUPAC name is 9-(3,4-dimethylpentan-2-yl)-9-borabicyclo[3.3.1]nonane.
| Compound Name | 9-(3,4-dimethylpentan-2-yl)-9-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 135048513 |
| Molecular Formula | C15H29B |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.24 |
| IUPAC Name | 9-(3,4-dimethylpentan-2-yl)-9-borabicyclo[3.3.1]nonane |
| SMILES | CC(C)C(C)C(C)B1C2CCCC1CCC2 |
| InChI | InChI=1S/C15H29B/c1-11(2)12(3)13(4)16-14-7-5-8-15(16)10-6-9-14/h11-15H,5-10H2,1-4H3 |
| InChIKey | QCIRXFNUNGDONE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|