C39H76S4Si6Sn — CID 135049235
[[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4-di(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane (PubChem CID 135049235) has the molecular formula C39H76S4Si6Sn and a molecular weight of 960.53 g/mol. Its IUPAC name is [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4-di(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane.
| Compound Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4-di(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 135049235 |
| Molecular Formula | C39H76S4Si6Sn |
| Molecular Weight | 960.53 g/mol |
| Exact Mass | 960.25 |
| IUPAC Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4-di(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
| SMILES | CC(C)c1ccc([Sn]2(c3c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc3C([Si](C)(C)C)[Si](C)(C)C)SSSS2)c(C(C)C)c1 |
| InChI | InChI=1S/C27H59Si6.C12H17.H2S4.Sn/c1-28(2,3)25(29(4,5)6)22-19-23(26(30(7,8)9)31(10,11)12)21-24(20-22)27(32(13,14)15)33(16,17)18;1-9(2)11-6-5-7-12(8-11)10(3)4;1-3-4-2;/h19-20,25-27H,1-18H3;5-6,8-10H,1-4H3;1-2H;/q;;;+2/p-2 |
| InChIKey | VFPZRVVVVVQDNY-UHFFFAOYSA-L |
| XLogP | 14.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.53 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|