C25H27NO3 — CID 135049684
(1S,9R)-4,13-dimethoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaene (PubChem CID 135049684) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (1S,9R)-4,13-dimethoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaene.
| Compound Name | (1S,9R)-4,13-dimethoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaene |
|---|---|
| PubChem CID | 135049684 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1S,9R)-4,13-dimethoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10,13-pentaene |
| SMILES | COC1=C[C@]23CCN(C)[C@H](Cc4ccc(OC)c(Oc5ccccc5)c42)C3=CC1 |
| InChI | InChI=1S/C25H27NO3/c1-26-14-13-25-16-19(27-2)10-11-20(25)21(26)15-17-9-12-22(28-3)24(23(17)25)29-18-7-5-4-6-8-18/h4-9,11-12,16,21H,10,13-15H2,1-3H3/t21-,25+/m1/s1 |
| InChIKey | CUMXIOXRRFQYQP-BWKNWUBXSA-N |
| XLogP | 4.85 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|