C24H29NO4 — CID 154733713
(1R,9R,10S,13R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol (PubChem CID 154733713) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (1R,9R,10S,13R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol.
| Compound Name | (1R,9R,10S,13R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol |
|---|---|
| PubChem CID | 154733713 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (1R,9R,10S,13R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-10,13-diol |
| SMILES | COc1ccc2c(c1Oc1ccccc1)[C@]13CCN(C)[C@H](C2)[C@]1(O)CC[C@@H](O)C3 |
| InChI | InChI=1S/C24H29NO4/c1-25-13-12-23-15-17(26)10-11-24(23,27)20(25)14-16-8-9-19(28-2)22(21(16)23)29-18-6-4-3-5-7-18/h3-9,17,20,26-27H,10-15H2,1-2H3/t17-,20-,23-,24-/m1/s1 |
| InChIKey | LNTKTHRCLPOSEL-RWAPRDRVSA-N |
| XLogP | 3.26 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |