C16H25ClO2 — CID 135050128
6-[2-(2-chloroethyl)-3-methylbut-2-enyl]-3-ethoxy-5-methylcyclohex-2-en-1-one (PubChem CID 135050128) has the molecular formula C16H25ClO2 and a molecular weight of 284.83 g/mol. Its IUPAC name is 6-[2-(2-chloroethyl)-3-methylbut-2-enyl]-3-ethoxy-5-methylcyclohex-2-en-1-one.
| Compound Name | 6-[2-(2-chloroethyl)-3-methylbut-2-enyl]-3-ethoxy-5-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135050128 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 6-[2-(2-chloroethyl)-3-methylbut-2-enyl]-3-ethoxy-5-methylcyclohex-2-en-1-one |
| SMILES | CCOC1=CC(=O)C(CC(CCCl)=C(C)C)C(C)C1 |
| InChI | InChI=1S/C16H25ClO2/c1-5-19-14-8-12(4)15(16(18)10-14)9-13(6-7-17)11(2)3/h10,12,15H,5-9H2,1-4H3 |
| InChIKey | OLOQCSNOJBAQPE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|