C20H35ClO2Sn — CID 11048840
6-[(Z)-6-chloro-3-trimethylstannylhex-2-enyl]-2-methyl-3-(2-methylpropoxy)cyclohex-2-en-1-one (PubChem CID 11048840) has the molecular formula C20H35ClO2Sn and a molecular weight of 461.66 g/mol. Its IUPAC name is 6-[(Z)-6-chloro-3-trimethylstannylhex-2-enyl]-2-methyl-3-(2-methylpropoxy)cyclohex-2-en-1-one.
| Compound Name | 6-[(Z)-6-chloro-3-trimethylstannylhex-2-enyl]-2-methyl-3-(2-methylpropoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11048840 |
| Molecular Formula | C20H35ClO2Sn |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 6-[(Z)-6-chloro-3-trimethylstannylhex-2-enyl]-2-methyl-3-(2-methylpropoxy)cyclohex-2-en-1-one |
| SMILES | CC1=C(OCC(C)C)CCC(C/C=C(/CCCCl)[Sn](C)(C)C)C1=O |
| InChI | InChI=1S/C17H26ClO2.3CH3.Sn/c1-13(2)12-20-16-10-9-15(17(19)14(16)3)8-6-4-5-7-11-18;;;;/h6,13,15H,5,7-12H2,1-3H3;3*1H3; |
| InChIKey | RLILMKOZBZFWDD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|