C23H35ClO2 — CID 145002008
2-chloro-3-methoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 145002008) has the molecular formula C23H35ClO2 and a molecular weight of 378.98 g/mol. Its IUPAC name is 2-chloro-3-methoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | 2-chloro-3-methoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 145002008 |
| Molecular Formula | C23H35ClO2 |
| Molecular Weight | 378.98 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-chloro-3-methoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1=C(Cl)C(=O)CC(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1C |
| InChI | InChI=1S/C23H35ClO2/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-20-15-21(25)22(24)23(26-6)19(20)5/h9,11,13,19-20H,7-8,10,12,14-15H2,1-6H3/b17-11+,18-13+ |
| InChIKey | IJHASZZQWAYYFB-OUBUNXTGSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.98 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|