C27H31NO2Si — CID 135050660
tert-butyl N-but-3-enyl-N-triphenylsilylcarbamate (PubChem CID 135050660) has the molecular formula C27H31NO2Si and a molecular weight of 429.64 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-triphenylsilylcarbamate.
| Compound Name | tert-butyl N-but-3-enyl-N-triphenylsilylcarbamate |
|---|---|
| PubChem CID | 135050660 |
| Molecular Formula | C27H31NO2Si |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-triphenylsilylcarbamate |
| SMILES | C=CCCN(C(=O)OC(C)(C)C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO2Si/c1-5-6-22-28(26(29)30-27(2,3)4)31(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h5,7-21H,1,6,22H2,2-4H3 |
| InChIKey | FHTSUCMWZREMEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|