C19H20N4O3S — CID 135052055
N-(5-benzoyl-3-propyltriazol-4-yl)-4-methylbenzenesulfonamide (PubChem CID 135052055) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(5-benzoyl-3-propyltriazol-4-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(5-benzoyl-3-propyltriazol-4-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135052055 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(5-benzoyl-3-propyltriazol-4-yl)-4-methylbenzenesulfonamide |
| SMILES | CCCn1nnc(C(=O)c2ccccc2)c1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N4O3S/c1-3-13-23-19(21-27(25,26)16-11-9-14(2)10-12-16)17(20-22-23)18(24)15-7-5-4-6-8-15/h4-12,21H,3,13H2,1-2H3 |
| InChIKey | XCGBBCDFEZZKPT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |