C13H16N4O4S — CID 44603089
ethyl 5-methyl-1-[(4-methylphenyl)sulfonylamino]triazole-4-carboxylate (PubChem CID 44603089) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is ethyl 5-methyl-1-[(4-methylphenyl)sulfonylamino]triazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[(4-methylphenyl)sulfonylamino]triazole-4-carboxylate |
|---|---|
| PubChem CID | 44603089 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | ethyl 5-methyl-1-[(4-methylphenyl)sulfonylamino]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(NS(=O)(=O)c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C13H16N4O4S/c1-4-21-13(18)12-10(3)17(15-14-12)16-22(19,20)11-7-5-9(2)6-8-11/h5-8,16H,4H2,1-3H3 |
| InChIKey | WURWSMFTQCAXFR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |