C24H24Cl4N8O4 — CID 139196984
ethyl 1-(2,5-dichloroanilino)-5-methyltriazole-4-carboxylate (PubChem CID 139196984) has the molecular formula C24H24Cl4N8O4 and a molecular weight of 630.32 g/mol. Its IUPAC name is ethyl 1-(2,5-dichloroanilino)-5-methyltriazole-4-carboxylate.
| Compound Name | ethyl 1-(2,5-dichloroanilino)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 139196984 |
| Molecular Formula | C24H24Cl4N8O4 |
| Molecular Weight | 630.32 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | ethyl 1-(2,5-dichloroanilino)-5-methyltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Nc2cc(Cl)ccc2Cl)c1C.CCOC(=O)c1nnn(Nc2cc(Cl)ccc2Cl)c1C |
| InChI | InChI=1S/2C12H12Cl2N4O2/c2*1-3-20-12(19)11-7(2)18(17-15-11)16-10-6-8(13)4-5-9(10)14/h2*4-6,16H,3H2,1-2H3 |
| InChIKey | FSXWLVUQULDCOV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |