C18H16F3NO3 — CID 135053034
(Z)-4-(3,4-dimethoxyanilino)-1,1,1-trifluoro-4-phenylbut-3-en-2-one (PubChem CID 135053034) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is (Z)-4-(3,4-dimethoxyanilino)-1,1,1-trifluoro-4-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-(3,4-dimethoxyanilino)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 135053034 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (Z)-4-(3,4-dimethoxyanilino)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
| SMILES | COc1ccc(N/C(=C\C(=O)C(F)(F)F)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H16F3NO3/c1-24-15-9-8-13(10-16(15)25-2)22-14(11-17(23)18(19,20)21)12-6-4-3-5-7-12/h3-11,22H,1-2H3/b14-11- |
| InChIKey | UJSLMJQTECZFSO-KAMYIIQDSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|