C42H79N3S2Si2 — CID 135053678
[7-(2-octyldecyl)-10-tri(propan-2-yl)silyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-tri(propan-2-yl)silane (PubChem CID 135053678) has the molecular formula C42H79N3S2Si2 and a molecular weight of 746.42 g/mol. Its IUPAC name is [7-(2-octyldecyl)-10-tri(propan-2-yl)silyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-tri(propan-2-yl)silane.
| Compound Name | [7-(2-octyldecyl)-10-tri(propan-2-yl)silyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135053678 |
| Molecular Formula | C42H79N3S2Si2 |
| Molecular Weight | 746.42 g/mol |
| Exact Mass | 745.53 |
| IUPAC Name | [7-(2-octyldecyl)-10-tri(propan-2-yl)silyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-tri(propan-2-yl)silane |
| SMILES | CCCCCCCCC(CCCCCCCC)Cn1c2nc([Si](C(C)C)(C(C)C)C(C)C)sc2c2sc([Si](C(C)C)(C(C)C)C(C)C)nc21 |
| InChI | InChI=1S/C42H79N3S2Si2/c1-15-17-19-21-23-25-27-36(28-26-24-22-20-18-16-2)29-45-39-37(46-41(43-39)48(30(3)4,31(5)6)32(7)8)38-40(45)44-42(47-38)49(33(9)10,34(11)12)35(13)14/h30-36H,15-29H2,1-14H3 |
| InChIKey | GKRYRYDLSIKDOK-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.42 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|