C20H30O5 — CID 135054211
dimethyl (3aS,5E,8E,9aR)-6-(methoxymethyl)-8-propan-2-yl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 135054211) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is dimethyl (3aS,5E,8E,9aR)-6-(methoxymethyl)-8-propan-2-yl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,5E,8E,9aR)-6-(methoxymethyl)-8-propan-2-yl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135054211 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | dimethyl (3aS,5E,8E,9aR)-6-(methoxymethyl)-8-propan-2-yl-1,3,3a,4,7,9a-hexahydrocyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | COC/C1=C/C[C@H]2CC(C(=O)OC)(C(=O)OC)C[C@H]2/C=C(/C(C)C)C1 |
| InChI | InChI=1S/C20H30O5/c1-13(2)16-8-14(12-23-3)6-7-15-10-20(18(21)24-4,19(22)25-5)11-17(15)9-16/h6,9,13,15,17H,7-8,10-12H2,1-5H3/b14-6+,16-9+/t15-,17+/m0/s1 |
| InChIKey | BPPUGWIKNBVPCG-YKSNHCFDSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|