About trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol
trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol (PubChem CID 135054569) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol |
| PubChem CID | 135054569 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol |
| SMILES | CCC[C@@H]1CCC[C@@]1(O)CCC |
| InChI | InChI=1S/C11H22O/c1-3-6-10-7-5-9-11(10,12)8-4-2/h10,12H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | KYAKIPVMGYBCER-MNOVXSKESA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol?
The IUPAC name of trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol (CID 135054569) is trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol.
What is the SMILES notation for trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol?
The canonical SMILES for trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol is CCC[C@@H]1CCC[C@@]1(O)CCC.
What is the InChIKey of trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol?
The InChIKey is KYAKIPVMGYBCER-MNOVXSKESA-N. The full InChI is InChI=1S/C11H22O/c1-3-6-10-7-5-9-11(10,12)8-4-2/h10,12H,3-9H2,1-2H3/t10-,11+/m1/s1.
What are the key properties of trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol?
trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol has a molecular weight of 170.30 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1,2-dipropylcyclopentan-1-ol is sourced from PubChem (CID 135054569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).