C15H28 — CID 158981751
(4aR,8aS)-4a,8a-dimethyl-1-propyl-1,2,3,4,5,6,7,8-octahydronaphthalene (PubChem CID 158981751) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (4aR,8aS)-4a,8a-dimethyl-1-propyl-1,2,3,4,5,6,7,8-octahydronaphthalene.
| Compound Name | (4aR,8aS)-4a,8a-dimethyl-1-propyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 158981751 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (4aR,8aS)-4a,8a-dimethyl-1-propyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
| SMILES | CCCC1CCC[C@@]2(C)CCCC[C@@]12C |
| InChI | InChI=1S/C15H28/c1-4-8-13-9-7-11-14(2)10-5-6-12-15(13,14)3/h13H,4-12H2,1-3H3/t13?,14-,15+/m1/s1 |
| InChIKey | BCTZQVOTQWUHRJ-DMJDIKPUSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |