C10H19NO3 — CID 135054968
(2S,3S)-2-ethyl-5-methyl-3-(nitromethyl)hexanal (PubChem CID 135054968) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (2S,3S)-2-ethyl-5-methyl-3-(nitromethyl)hexanal.
| Compound Name | (2S,3S)-2-ethyl-5-methyl-3-(nitromethyl)hexanal |
|---|---|
| PubChem CID | 135054968 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (2S,3S)-2-ethyl-5-methyl-3-(nitromethyl)hexanal |
| SMILES | CC[C@H](C=O)[C@H](CC(C)C)C[N+](=O)[O-] |
| InChI | InChI=1S/C10H19NO3/c1-4-9(7-12)10(5-8(2)3)6-11(13)14/h7-10H,4-6H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | OVPXWCACSURXRK-NXEZZACHSA-N |
| XLogP | 2.15 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|